C18H24BNO4 — CID 140728319
1-ethoxy-6-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (PubChem CID 140728319) has the molecular formula C18H24BNO4 and a molecular weight of 329.21 g/mol. Its IUPAC name is 1-ethoxy-6-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline.
| Compound Name | 1-ethoxy-6-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
|---|---|
| PubChem CID | 140728319 |
| Molecular Formula | C18H24BNO4 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 1-ethoxy-6-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
| SMILES | CCOc1nccc2cc(OC)c(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C18H24BNO4/c1-7-22-16-13-11-14(15(21-6)10-12(13)8-9-20-16)19-23-17(2,3)18(4,5)24-19/h8-11H,7H2,1-6H3 |
| InChIKey | FTHAZWLZPJURPZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|