About CID 140728920
CID 140728920 (PubChem CID 140728920) has the molecular formula C11H8AlO
and a molecular weight of 183.17 g/mol.
Molecular Properties
| Compound Name | CID 140728920 |
| PubChem CID | 140728920 |
| Molecular Formula | C11H8AlO |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | — |
| SMILES | Cc1ccc2cccc3c2c1[Al]O3 |
| InChI | InChI=1S/C11H9O.Al/c1-8-5-6-9-3-2-4-11(12)10(9)7-8;/h2-6,12H,1H3;/q;+1/p-1 |
| InChIKey | FBGVPXOLSPKPHW-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 140728920 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140728920?
The IUPAC name of CID 140728920 (CID 140728920) is not available.
What is the SMILES notation for CID 140728920?
The canonical SMILES for CID 140728920 is Cc1ccc2cccc3c2c1[Al]O3.
What is the InChIKey of CID 140728920?
The InChIKey is FBGVPXOLSPKPHW-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H9O.Al/c1-8-5-6-9-3-2-4-11(12)10(9)7-8;/h2-6,12H,1H3;/q;+1/p-1.
What are the key properties of CID 140728920?
CID 140728920 has a molecular weight of 183.17 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140728920 is sourced from PubChem (CID 140728920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).