C10H8N2O2 — CID 140733006
1,2-benzoxazepine-7-carboxamide (PubChem CID 140733006) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 1,2-benzoxazepine-7-carboxamide.
| Compound Name | 1,2-benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 140733006 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1,2-benzoxazepine-7-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C=CC=NO2 |
| InChI | InChI=1S/C10H8N2O2/c11-10(13)8-3-4-9-7(6-8)2-1-5-12-14-9/h1-6H,(H2,11,13) |
| InChIKey | OWZPXFISVMGIEO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |