C11H11NO2 — CID 144848869
2,3-dihydro-1-benzoxepine-7-carboxamide (PubChem CID 144848869) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2,3-dihydro-1-benzoxepine-7-carboxamide.
| Compound Name | 2,3-dihydro-1-benzoxepine-7-carboxamide |
|---|---|
| PubChem CID | 144848869 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2,3-dihydro-1-benzoxepine-7-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C=CCCO2 |
| InChI | InChI=1S/C11H11NO2/c12-11(13)9-4-5-10-8(7-9)3-1-2-6-14-10/h1,3-5,7H,2,6H2,(H2,12,13) |
| InChIKey | FVCROWBEDAMVSP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |