C10H10N2O — CID 67281504
1,2-dihydroisoquinoline-7-carboxamide (PubChem CID 67281504) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 1,2-dihydroisoquinoline-7-carboxamide.
| Compound Name | 1,2-dihydroisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 67281504 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 1,2-dihydroisoquinoline-7-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)CNC=C2 |
| InChI | InChI=1S/C10H10N2O/c11-10(13)8-2-1-7-3-4-12-6-9(7)5-8/h1-5,12H,6H2,(H2,11,13) |
| InChIKey | OHWJRIJFKQXPJW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |