C28H26N2O — CID 140733491
N-[2-(2-methylhepta-2,4,6-trien-3-yl)benzo[g]indol-1-yl]-2-phenylacetamide (PubChem CID 140733491) has the molecular formula C28H26N2O and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[2-(2-methylhepta-2,4,6-trien-3-yl)benzo[g]indol-1-yl]-2-phenylacetamide.
| Compound Name | N-[2-(2-methylhepta-2,4,6-trien-3-yl)benzo[g]indol-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 140733491 |
| Molecular Formula | C28H26N2O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[2-(2-methylhepta-2,4,6-trien-3-yl)benzo[g]indol-1-yl]-2-phenylacetamide |
| SMILES | C=CC=CC(=C(C)C)c1cc2ccc3ccccc3c2n1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C28H26N2O/c1-4-5-14-24(20(2)3)26-19-23-17-16-22-13-9-10-15-25(22)28(23)30(26)29-27(31)18-21-11-7-6-8-12-21/h4-17,19H,1,18H2,2-3H3,(H,29,31) |
| InChIKey | FEGYUUNIYSWLSM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|