C32H36N2O4S — CID 140733490
butane-1-sulfonate;N-[2-(2-methylhepta-2,4,6-trien-3-yl)-1H-benzo[g]indol-1-ium-1-yl]-2-phenylacetamide (PubChem CID 140733490) has the molecular formula C32H36N2O4S and a molecular weight of 544.72 g/mol. Its IUPAC name is butane-1-sulfonate;N-[2-(2-methylhepta-2,4,6-trien-3-yl)-1H-benzo[g]indol-1-ium-1-yl]-2-phenylacetamide.
| Compound Name | butane-1-sulfonate;N-[2-(2-methylhepta-2,4,6-trien-3-yl)-1H-benzo[g]indol-1-ium-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 140733490 |
| Molecular Formula | C32H36N2O4S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | butane-1-sulfonate;N-[2-(2-methylhepta-2,4,6-trien-3-yl)-1H-benzo[g]indol-1-ium-1-yl]-2-phenylacetamide |
| SMILES | C=CC=CC(C1=Cc2ccc3ccccc3c2[NH+]1NC(=O)Cc1ccccc1)=C(C)C.CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C28H26N2O.C4H10O3S/c1-4-5-14-24(20(2)3)26-19-23-17-16-22-13-9-10-15-25(22)28(23)30(26)29-27(31)18-21-11-7-6-8-12-21;1-2-3-4-8(5,6)7/h4-17,19H,1,18H2,2-3H3,(H,29,31);2-4H2,1H3,(H,5,6,7) |
| InChIKey | OHROMMXCGKJWEF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|