C47H41O9- — CID 140735034
4-[[3-[[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-yl]oxymethyl]phenyl]methoxy]-4-oxobutanoate (PubChem CID 140735034) has the molecular formula C47H41O9- and a molecular weight of 749.84 g/mol. Its IUPAC name is 4-[[3-[[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-yl]oxymethyl]phenyl]methoxy]-4-oxobutanoate.
| Compound Name | 4-[[3-[[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-yl]oxymethyl]phenyl]methoxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 140735034 |
| Molecular Formula | C47H41O9- |
| Molecular Weight | 749.84 g/mol |
| Exact Mass | 749.28 |
| IUPAC Name | 4-[[3-[[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-yl]oxymethyl]phenyl]methoxy]-4-oxobutanoate |
| SMILES | COc1ccc(C(OCc2ccc3c(c2)OCc2cc(OCc4cccc(COC(=O)CCC(=O)[O-])c4)ccc2-3)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C47H42O9/c1-51-39-16-12-37(13-17-39)47(36-9-4-3-5-10-36,38-14-18-40(52-2)19-15-38)56-30-34-11-21-43-42-22-20-41(27-35(42)31-54-44(43)26-34)53-28-32-7-6-8-33(25-32)29-55-46(50)24-23-45(48)49/h3-22,25-27H,23-24,28-31H2,1-2H3,(H,48,49)/p-1 |
| InChIKey | WLWGEUNYSFPJSL-UHFFFAOYSA-M |
| XLogP | 7.92 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.84 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|