C44H44O5 — CID 144823066
3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-ol;(3Z)-2,6-dimethylhepta-1,3,5-triene (PubChem CID 144823066) has the molecular formula C44H44O5 and a molecular weight of 652.83 g/mol. Its IUPAC name is 3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-ol;(3Z)-2,6-dimethylhepta-1,3,5-triene.
| Compound Name | 3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-ol;(3Z)-2,6-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144823066 |
| Molecular Formula | C44H44O5 |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.32 |
| IUPAC Name | 3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-ol;(3Z)-2,6-dimethylhepta-1,3,5-triene |
| SMILES | C=C(C)/C=C\C=C(C)C.COc1ccc(C(OCc2ccc3c(c2)OCc2cc(O)ccc2-3)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H30O5.C9H14/c1-37-30-14-9-27(10-15-30)35(26-6-4-3-5-7-26,28-11-16-31(38-2)17-12-28)40-22-24-8-18-33-32-19-13-29(36)21-25(32)23-39-34(33)20-24;1-8(2)6-5-7-9(3)4/h3-21,36H,22-23H2,1-2H3;5-7H,1H2,2-4H3/b;6-5- |
| InChIKey | RDUOYGMAFGKURN-JXGYXAOLSA-N |
| XLogP | 10.56 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|