C43H44O8 — CID 144822255
4-O-[[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-yl]methyl] 1-O-methyl butanedioate;ethane (PubChem CID 144822255) has the molecular formula C43H44O8 and a molecular weight of 688.82 g/mol. Its IUPAC name is 4-O-[[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-yl]methyl] 1-O-methyl butanedioate;ethane.
| Compound Name | 4-O-[[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-yl]methyl] 1-O-methyl butanedioate;ethane |
|---|---|
| PubChem CID | 144822255 |
| Molecular Formula | C43H44O8 |
| Molecular Weight | 688.82 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | 4-O-[[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6H-benzo[c]chromen-8-yl]methyl] 1-O-methyl butanedioate;ethane |
| SMILES | CC.COC(=O)CCC(=O)OCc1ccc2c(c1)COc1cc(COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)ccc1-2 |
| InChI | InChI=1S/C41H38O8.C2H6/c1-44-34-15-11-32(12-16-34)41(31-7-5-4-6-8-31,33-13-17-35(45-2)18-14-33)49-26-29-10-20-37-36-19-9-28(23-30(36)27-47-38(37)24-29)25-48-40(43)22-21-39(42)46-3;1-2/h4-20,23-24H,21-22,25-27H2,1-3H3;1-2H3 |
| InChIKey | SOTTVWXKWUKWHE-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.82 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|