C30H19N3Pt — CID 140735868
4,18-di(phenyl)-1,3,19-triazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene;platinum(2+) (PubChem CID 140735868) has the molecular formula C30H19N3Pt and a molecular weight of 616.58 g/mol. Its IUPAC name is 4,18-di(phenyl)-1,3,19-triazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene;platinum(2+).
| Compound Name | 4,18-di(phenyl)-1,3,19-triazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene;platinum(2+) |
|---|---|
| PubChem CID | 140735868 |
| Molecular Formula | C30H19N3Pt |
| Molecular Weight | 616.58 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | 4,18-di(phenyl)-1,3,19-triazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1-c1ccc2c(n1)N1c3nc(-c4[c-]cccc4)ccc3Cc3cccc(c31)C2 |
| InChI | InChI=1S/C30H19N3.Pt/c1-3-8-20(9-4-1)26-16-14-24-18-22-12-7-13-23-19-25-15-17-27(21-10-5-2-6-11-21)32-30(25)33(28(22)23)29(24)31-26;/h1-8,10,12-17H,18-19H2;/q-2;+2 |
| InChIKey | FQWCTMZDCWZMGD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.58 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|