C15H9NO2S — CID 140738360
(2Z)-2-isocyano-2-(2-methylindeno[2,1-b]thiophen-4-ylidene)acetic acid (PubChem CID 140738360) has the molecular formula C15H9NO2S and a molecular weight of 267.31 g/mol. Its IUPAC name is (2Z)-2-isocyano-2-(2-methylindeno[2,1-b]thiophen-4-ylidene)acetic acid.
| Compound Name | (2Z)-2-isocyano-2-(2-methylindeno[2,1-b]thiophen-4-ylidene)acetic acid |
|---|---|
| PubChem CID | 140738360 |
| Molecular Formula | C15H9NO2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | (2Z)-2-isocyano-2-(2-methylindeno[2,1-b]thiophen-4-ylidene)acetic acid |
| SMILES | [C-]#[N+]/C(C(=O)O)=C1/c2ccccc2-c2cc(C)sc21 |
| InChI | InChI=1S/C15H9NO2S/c1-8-7-11-9-5-3-4-6-10(9)12(14(11)19-8)13(16-2)15(17)18/h3-7H,1H3,(H,17,18)/b13-12- |
| InChIKey | VTQPGJCZKDVSCW-SEYXRHQNSA-N |
| XLogP | 3.80 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|