C28H22N2 — CID 140745309
2-(3,5-dimethylphenyl)-6,8-diphenylquinazoline (PubChem CID 140745309) has the molecular formula C28H22N2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-6,8-diphenylquinazoline.
| Compound Name | 2-(3,5-dimethylphenyl)-6,8-diphenylquinazoline |
|---|---|
| PubChem CID | 140745309 |
| Molecular Formula | C28H22N2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-6,8-diphenylquinazoline |
| SMILES | Cc1cc(C)cc(-c2ncc3cc(-c4ccccc4)cc(-c4ccccc4)c3n2)c1 |
| InChI | InChI=1S/C28H22N2/c1-19-13-20(2)15-24(14-19)28-29-18-25-16-23(21-9-5-3-6-10-21)17-26(27(25)30-28)22-11-7-4-8-12-22/h3-18H,1-2H3 |
| InChIKey | TUNQUQIQXYARDS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |