C22H34O4Si4 — CID 140746969
ethenyl-[[ethenyl(dimethyl)silyl]oxy-methyl-[methyl(diphenyl)silyl]oxysilyl]peroxy-dimethylsilane (PubChem CID 140746969) has the molecular formula C22H34O4Si4 and a molecular weight of 474.85 g/mol. Its IUPAC name is ethenyl-[[ethenyl(dimethyl)silyl]oxy-methyl-[methyl(diphenyl)silyl]oxysilyl]peroxy-dimethylsilane.
| Compound Name | ethenyl-[[ethenyl(dimethyl)silyl]oxy-methyl-[methyl(diphenyl)silyl]oxysilyl]peroxy-dimethylsilane |
|---|---|
| PubChem CID | 140746969 |
| Molecular Formula | C22H34O4Si4 |
| Molecular Weight | 474.85 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | ethenyl-[[ethenyl(dimethyl)silyl]oxy-methyl-[methyl(diphenyl)silyl]oxysilyl]peroxy-dimethylsilane |
| SMILES | C=C[Si](C)(C)OO[Si](C)(O[Si](C)(C)C=C)O[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H34O4Si4/c1-9-27(3,4)23-24-30(8,25-28(5,6)10-2)26-29(7,21-17-13-11-14-18-21)22-19-15-12-16-20-22/h9-20H,1-2H2,3-8H3 |
| InChIKey | DDMPGTCBTOXLDN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|