About [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane
[2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane (PubChem CID 140750847) has the molecular formula C14H35FO7Si3
and a molecular weight of 418.68 g/mol. Its IUPAC name is [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane |
| PubChem CID | 140750847 |
| Molecular Formula | C14H35FO7Si3 |
| Molecular Weight | 418.68 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane |
| SMILES | CO[Si](CCCC(F)(C[Si](OC)(OC)OC)O[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C14H35FO7Si3/c1-16-24(17-2,18-3)12-10-11-14(15,22-23(7,8)9)13-25(19-4,20-5)21-6/h10-13H2,1-9H3 |
| InChIKey | KYDMVWCSVNQHQG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.68 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane?
The IUPAC name of [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane (CID 140750847) is [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane.
What is the SMILES notation for [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane?
The canonical SMILES for [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane is CO[Si](CCCC(F)(C[Si](OC)(OC)OC)O[Si](C)(C)C)(OC)OC.
What is the InChIKey of [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane?
The InChIKey is KYDMVWCSVNQHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H35FO7Si3/c1-16-24(17-2,18-3)12-10-11-14(15,22-23(7,8)9)13-25(19-4,20-5)21-6/h10-13H2,1-9H3.
What are the key properties of [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane?
[2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane has a molecular weight of 418.68 g/mol, XLogP of 3.04, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane is sourced from PubChem (CID 140750847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).