C14H35FO7Si3 — CID 140750847
[2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane (PubChem CID 140750847) has the molecular formula C14H35FO7Si3 and a molecular weight of 418.68 g/mol. Its IUPAC name is [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane.
| Compound Name | [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 140750847 |
| Molecular Formula | C14H35FO7Si3 |
| Molecular Weight | 418.68 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxy-trimethylsilane |
| SMILES | CO[Si](CCCC(F)(C[Si](OC)(OC)OC)O[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C14H35FO7Si3/c1-16-24(17-2,18-3)12-10-11-14(15,22-23(7,8)9)13-25(19-4,20-5)21-6/h10-13H2,1-9H3 |
| InChIKey | KYDMVWCSVNQHQG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.68 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|