C31H36IrN2-2 — CID 140756437
CID 140756437 (PubChem CID 140756437) has the molecular formula C31H36IrN2-2 and a molecular weight of 628.86 g/mol.
| Compound Name | CID 140756437 |
|---|---|
| PubChem CID | 140756437 |
| Molecular Formula | C31H36IrN2-2 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]cc3c(c2)C2(C)CCC3(C)CC2)c2cc3c(cc21)C1CC2CC(C1)CC3C2.[Ir] |
| InChI | InChI=1S/C31H36N2.Ir/c1-30-6-8-31(2,9-7-30)27-15-23(4-5-26(27)30)33-18-32(3)28-16-24-21-11-19-10-20(12-21)14-22(13-19)25(24)17-29(28)33;/h5,15-22H,6-14H2,1-3H3;/q-2; |
| InChIKey | VOKIJAHUUXMTAN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|