C24H26N2O6S2 — CID 140766386
bis(1-ethylpyridin-1-ium);naphthalene-1,5-disulfonate (PubChem CID 140766386) has the molecular formula C24H26N2O6S2 and a molecular weight of 502.61 g/mol. Its IUPAC name is bis(1-ethylpyridin-1-ium);naphthalene-1,5-disulfonate.
| Compound Name | bis(1-ethylpyridin-1-ium);naphthalene-1,5-disulfonate |
|---|---|
| PubChem CID | 140766386 |
| Molecular Formula | C24H26N2O6S2 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | bis(1-ethylpyridin-1-ium);naphthalene-1,5-disulfonate |
| SMILES | CC[n+]1ccccc1.CC[n+]1ccccc1.O=S(=O)([O-])c1cccc2c(S(=O)(=O)[O-])cccc12 |
| InChI | InChI=1S/C10H8O6S2.2C7H10N/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;2*1-2-8-6-4-3-5-7-8/h1-6H,(H,11,12,13)(H,14,15,16);2*3-7H,2H2,1H3/q;2*+1/p-2 |
| InChIKey | XDYUBMJZERSXEZ-UHFFFAOYSA-L |
| XLogP | 2.64 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|