C23H23N5O6S — CID 140768813
[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxo-1-[5-[4-(triazol-2-yl)phenyl]indol-1-yl]butan-2-yl] formate (PubChem CID 140768813) has the molecular formula C23H23N5O6S and a molecular weight of 497.53 g/mol. Its IUPAC name is [(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxo-1-[5-[4-(triazol-2-yl)phenyl]indol-1-yl]butan-2-yl] formate.
| Compound Name | [(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxo-1-[5-[4-(triazol-2-yl)phenyl]indol-1-yl]butan-2-yl] formate |
|---|---|
| PubChem CID | 140768813 |
| Molecular Formula | C23H23N5O6S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxo-1-[5-[4-(triazol-2-yl)phenyl]indol-1-yl]butan-2-yl] formate |
| SMILES | C[C@](C(=O)NO)(C(Cn1ccc2cc(-c3ccc(-n4nccn4)cc3)ccc21)OC=O)S(C)(=O)=O |
| InChI | InChI=1S/C23H23N5O6S/c1-23(22(30)26-31,35(2,32)33)21(34-15-29)14-27-12-9-18-13-17(5-8-20(18)27)16-3-6-19(7-4-16)28-24-10-11-25-28/h3-13,15,21,31H,14H2,1-2H3,(H,26,30)/t21?,23-/m1/s1 |
| InChIKey | LVOGJDVSULVMEI-JFGZAKSSSA-N |
| XLogP | 1.74 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|