C27H31BFNO5 — CID 140801136
1-[4-(5-fluoro-2-methoxy-4-pyridinyl)phenyl]-2-[2-(hydroxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol (PubChem CID 140801136) has the molecular formula C27H31BFNO5 and a molecular weight of 479.36 g/mol. Its IUPAC name is 1-[4-(5-fluoro-2-methoxy-4-pyridinyl)phenyl]-2-[2-(hydroxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol.
| Compound Name | 1-[4-(5-fluoro-2-methoxy-4-pyridinyl)phenyl]-2-[2-(hydroxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 140801136 |
| Molecular Formula | C27H31BFNO5 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 1-[4-(5-fluoro-2-methoxy-4-pyridinyl)phenyl]-2-[2-(hydroxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol |
| SMILES | COc1cc(-c2ccc(C(O)Cc3cc(B4OC(C)(C)C(C)(C)O4)ccc3CO)cc2)c(F)cn1 |
| InChI | InChI=1S/C27H31BFNO5/c1-26(2)27(3,4)35-28(34-26)21-11-10-19(16-31)20(12-21)13-24(32)18-8-6-17(7-9-18)22-14-25(33-5)30-15-23(22)29/h6-12,14-15,24,31-32H,13,16H2,1-5H3 |
| InChIKey | YGHJISSTDRRXBE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|