C38H27AlN2O3S — CID 140803106
(4-dibenzothiophen-4-ylphenoxy)-bis[(2-methylquinolin-8-yl)oxy]alumane (PubChem CID 140803106) has the molecular formula C38H27AlN2O3S and a molecular weight of 618.69 g/mol. Its IUPAC name is (4-dibenzothiophen-4-ylphenoxy)-bis[(2-methylquinolin-8-yl)oxy]alumane.
| Compound Name | (4-dibenzothiophen-4-ylphenoxy)-bis[(2-methylquinolin-8-yl)oxy]alumane |
|---|---|
| PubChem CID | 140803106 |
| Molecular Formula | C38H27AlN2O3S |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | (4-dibenzothiophen-4-ylphenoxy)-bis[(2-methylquinolin-8-yl)oxy]alumane |
| SMILES | Cc1ccc2cccc(O[Al](Oc3ccc(-c4cccc5c4sc4ccccc45)cc3)Oc3cccc4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/C18H12OS.2C10H9NO.Al/c19-13-10-8-12(9-11-13)14-5-3-6-16-15-4-1-2-7-17(15)20-18(14)16;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h1-11,19H;2*2-6,12H,1H3;/q;;;+3/p-3 |
| InChIKey | ACWLQKJAYVGEOP-UHFFFAOYSA-K |
| XLogP | 9.96 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |