C27H17N2O3OsP+ — CID 140807980
2-benzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-yloxy-12H-imidazo[1,2-f]phenanthridin-12-ide;osmium(1+) (PubChem CID 140807980) has the molecular formula C27H17N2O3OsP+ and a molecular weight of 638.65 g/mol. Its IUPAC name is 2-benzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-yloxy-12H-imidazo[1,2-f]phenanthridin-12-ide;osmium(1+).
| Compound Name | 2-benzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-yloxy-12H-imidazo[1,2-f]phenanthridin-12-ide;osmium(1+) |
|---|---|
| PubChem CID | 140807980 |
| Molecular Formula | C27H17N2O3OsP+ |
| Molecular Weight | 638.65 g/mol |
| Exact Mass | 640.06 |
| IUPAC Name | 2-benzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-yloxy-12H-imidazo[1,2-f]phenanthridin-12-ide;osmium(1+) |
| SMILES | [Os+].[c-]1cccc2c1c1nc(O[PH+]3Oc4ccccc4-c4ccccc4O3)cn1c1ccccc21 |
| InChI | InChI=1S/C27H17N2O3P.Os/c1-2-13-22-18(9-1)19-10-3-6-14-23(19)29-17-26(28-27(22)29)32-33-30-24-15-7-4-11-20(24)21-12-5-8-16-25(21)31-33;/h1-12,14-17,33H;/q;+1 |
| InChIKey | CISFEHNSQYBNRK-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 44.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.65 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|