C34H18N6Pt — CID 140693830
CID 140693830 (PubChem CID 140693830) has the molecular formula C34H18N6Pt and a molecular weight of 705.64 g/mol.
| Compound Name | CID 140693830 |
|---|---|
| PubChem CID | 140693830 |
| Molecular Formula | C34H18N6Pt |
| Molecular Weight | 705.64 g/mol |
| Exact Mass | 705.12 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1ccnc2c1c1nc(-c3ccccc3-c3cn4c5ccccc5c5ncc[c-]c5c4n3)cn1c1ccccc21 |
| InChI | InChI=1S/C34H18N6.Pt/c1-2-10-22(28-20-40-30-16-6-4-12-24(30)32-26(34(40)38-28)14-8-18-36-32)21(9-1)27-19-39-29-15-5-3-11-23(29)31-25(33(39)37-27)13-7-17-35-31;/h1-12,15-20H;/q-2;+2 |
| InChIKey | VMJNVIKLKJOVRK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|