C32H18F2N4Pt — CID 58202854
11-fluoro-2-[2-(11-fluoro-12H-imidazo[1,2-f]phenanthridin-12-id-2-yl)ethyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 58202854) has the molecular formula C32H18F2N4Pt and a molecular weight of 691.60 g/mol. Its IUPAC name is 11-fluoro-2-[2-(11-fluoro-12H-imidazo[1,2-f]phenanthridin-12-id-2-yl)ethyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 11-fluoro-2-[2-(11-fluoro-12H-imidazo[1,2-f]phenanthridin-12-id-2-yl)ethyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 58202854 |
| Molecular Formula | C32H18F2N4Pt |
| Molecular Weight | 691.60 g/mol |
| Exact Mass | 691.11 |
| IUPAC Name | 11-fluoro-2-[2-(11-fluoro-12H-imidazo[1,2-f]phenanthridin-12-id-2-yl)ethyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | Fc1[c-]c2c(cc1)c1ccccc1n1cc(CCc3cn4c5ccccc5c5ccc(F)[c-]c5c4n3)nc21.[Pt+2] |
| InChI | InChI=1S/C32H18F2N4.Pt/c33-19-9-13-23-25-5-1-3-7-29(25)37-17-21(35-31(37)27(23)15-19)11-12-22-18-38-30-8-4-2-6-26(30)24-14-10-20(34)16-28(24)32(38)36-22;/h1-10,13-14,17-18H,11-12H2;/q-2;+2 |
| InChIKey | LVWBCGYHVRSELK-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.60 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|