C20H20Br4N2NiO — CID 140820924
1-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-N-(2,6-dibromophenyl)-1-phenylmethanimine;dibromonickel (PubChem CID 140820924) has the molecular formula C20H20Br4N2NiO and a molecular weight of 682.70 g/mol. Its IUPAC name is 1-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-N-(2,6-dibromophenyl)-1-phenylmethanimine;dibromonickel.
| Compound Name | 1-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-N-(2,6-dibromophenyl)-1-phenylmethanimine;dibromonickel |
|---|---|
| PubChem CID | 140820924 |
| Molecular Formula | C20H20Br4N2NiO |
| Molecular Weight | 682.70 g/mol |
| Exact Mass | 677.77 |
| IUPAC Name | 1-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-N-(2,6-dibromophenyl)-1-phenylmethanimine;dibromonickel |
| SMILES | Br[Ni]Br.CC(C)(C)[C@H]1COC(/C(=N/c2c(Br)cccc2Br)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H20Br2N2O.2BrH.Ni/c1-20(2,3)16-12-25-19(23-16)17(13-8-5-4-6-9-13)24-18-14(21)10-7-11-15(18)22;;;/h4-11,16H,12H2,1-3H3;2*1H;/q;;;+2/p-2/b24-17+;;;/t16-;;;/m1.../s1 |
| InChIKey | XMGRLJRFVJIEEL-RPWSQLHESA-L |
| XLogP | 7.86 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.70 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|