C28H38Br2N2NiO — CID 140820928
1-[(4R)-4-tert-butyl-4,5,6,7-tetrahydro-1,3-oxazepin-2-yl]-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine;dibromonickel (PubChem CID 140820928) has the molecular formula C28H38Br2N2NiO and a molecular weight of 637.13 g/mol. Its IUPAC name is 1-[(4R)-4-tert-butyl-4,5,6,7-tetrahydro-1,3-oxazepin-2-yl]-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine;dibromonickel.
| Compound Name | 1-[(4R)-4-tert-butyl-4,5,6,7-tetrahydro-1,3-oxazepin-2-yl]-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine;dibromonickel |
|---|---|
| PubChem CID | 140820928 |
| Molecular Formula | C28H38Br2N2NiO |
| Molecular Weight | 637.13 g/mol |
| Exact Mass | 634.07 |
| IUPAC Name | 1-[(4R)-4-tert-butyl-4,5,6,7-tetrahydro-1,3-oxazepin-2-yl]-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine;dibromonickel |
| SMILES | Br[Ni]Br.CC(C)c1cccc(C(C)C)c1/N=C(/C1=N[C@@H](C(C)(C)C)CCCO1)c1ccccc1 |
| InChI | InChI=1S/C28H38N2O.2BrH.Ni/c1-19(2)22-15-11-16-23(20(3)4)26(22)30-25(21-13-9-8-10-14-21)27-29-24(28(5,6)7)17-12-18-31-27;;;/h8-11,13-16,19-20,24H,12,17-18H2,1-7H3;2*1H;/q;;;+2/p-2/b30-25+;;;/t24-;;;/m1.../s1 |
| InChIKey | SLGIVUMGVQJEPS-YCTNTECQSA-L |
| XLogP | 9.37 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.13 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|