C28H30Br2N2NiO — CID 140820925
dibromonickel;N-[2,6-di(propan-2-yl)phenyl]-1-phenyl-1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methanimine (PubChem CID 140820925) has the molecular formula C28H30Br2N2NiO and a molecular weight of 629.06 g/mol. Its IUPAC name is dibromonickel;N-[2,6-di(propan-2-yl)phenyl]-1-phenyl-1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methanimine.
| Compound Name | dibromonickel;N-[2,6-di(propan-2-yl)phenyl]-1-phenyl-1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methanimine |
|---|---|
| PubChem CID | 140820925 |
| Molecular Formula | C28H30Br2N2NiO |
| Molecular Weight | 629.06 g/mol |
| Exact Mass | 626.01 |
| IUPAC Name | dibromonickel;N-[2,6-di(propan-2-yl)phenyl]-1-phenyl-1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methanimine |
| SMILES | Br[Ni]Br.CC(C)c1cccc(C(C)C)c1/N=C(/C1=NC(c2ccccc2)CO1)c1ccccc1 |
| InChI | InChI=1S/C28H30N2O.2BrH.Ni/c1-19(2)23-16-11-17-24(20(3)4)27(23)30-26(22-14-9-6-10-15-22)28-29-25(18-31-28)21-12-7-5-8-13-21;;;/h5-17,19-20,25H,18H2,1-4H3;2*1H;/q;;;+2/p-2/b30-26+;;; |
| InChIKey | PVYOMSKHXRQNIK-WYGBOJGQSA-L |
| XLogP | 8.91 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.06 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|