C40H48Br2S4Si2 — CID 140823942
2-[2,6-bis(3-bromothiophen-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]thieno[2,3-f][1]benzothiol-8-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 140823942) has the molecular formula C40H48Br2S4Si2 and a molecular weight of 873.07 g/mol. Its IUPAC name is 2-[2,6-bis(3-bromothiophen-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]thieno[2,3-f][1]benzothiol-8-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[2,6-bis(3-bromothiophen-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]thieno[2,3-f][1]benzothiol-8-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 140823942 |
| Molecular Formula | C40H48Br2S4Si2 |
| Molecular Weight | 873.07 g/mol |
| Exact Mass | 870.05 |
| IUPAC Name | 2-[2,6-bis(3-bromothiophen-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]thieno[2,3-f][1]benzothiol-8-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1c2cc(-c3sccc3Br)sc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cc(-c3sccc3Br)sc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H48Br2S4Si2/c1-23(2)47(24(3)4,25(5)6)19-15-29-31-21-35(39-33(41)13-17-43-39)46-38(31)30(16-20-48(26(7)8,27(9)10)28(11)12)32-22-36(45-37(29)32)40-34(42)14-18-44-40/h13-14,17-18,21-28H,1-12H3 |
| InChIKey | VWBQKWDQYFNPHJ-UHFFFAOYSA-N |
| XLogP | 16.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.07 |
| LogP ≤ 5 | 16.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|