C51H55IrN4O- — CID 140826374
1-[5-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]-2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]ethanone;iridium (PubChem CID 140826374) has the molecular formula C51H55IrN4O- and a molecular weight of 932.24 g/mol. Its IUPAC name is 1-[5-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]-2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]ethanone;iridium.
| Compound Name | 1-[5-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]-2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]ethanone;iridium |
|---|---|
| PubChem CID | 140826374 |
| Molecular Formula | C51H55IrN4O- |
| Molecular Weight | 932.24 g/mol |
| Exact Mass | 932.40 |
| IUPAC Name | 1-[5-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]-2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-3-pyridinyl]ethanone;iridium |
| SMILES | CC(=O)c1cc(-c2ccc(-c3nc(-c4ccc(C(C)(C)C)cc4)nc(-c4ccc(C(C)(C)C)cc4)n3)cc2)cnc1-c1[c-]cc2c(c1)C(C)(C)C(C)(C)C2(C)C.[Ir] |
| InChI | InChI=1S/C51H55N4O.Ir/c1-31(56)40-28-37(30-52-43(40)36-22-27-41-42(29-36)50(10,11)51(12,13)49(41,8)9)32-14-16-33(17-15-32)44-53-45(34-18-23-38(24-19-34)47(2,3)4)55-46(54-44)35-20-25-39(26-21-35)48(5,6)7;/h14-21,23-30H,1-13H3;/q-1; |
| InChIKey | QJWJTZFUNAWKAF-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.24 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|