C14H32N4O8Si2 — CID 140827461
1-(trimethoxysilylmethyl)-3-[(E)-4-(trimethoxysilylmethylcarbamoylamino)but-2-enyl]urea (PubChem CID 140827461) has the molecular formula C14H32N4O8Si2 and a molecular weight of 440.60 g/mol. Its IUPAC name is 1-(trimethoxysilylmethyl)-3-[(E)-4-(trimethoxysilylmethylcarbamoylamino)but-2-enyl]urea.
| Compound Name | 1-(trimethoxysilylmethyl)-3-[(E)-4-(trimethoxysilylmethylcarbamoylamino)but-2-enyl]urea |
|---|---|
| PubChem CID | 140827461 |
| Molecular Formula | C14H32N4O8Si2 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-(trimethoxysilylmethyl)-3-[(E)-4-(trimethoxysilylmethylcarbamoylamino)but-2-enyl]urea |
| SMILES | CO[Si](CNC(=O)NC/C=C/CNC(=O)NC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C14H32N4O8Si2/c1-21-27(22-2,23-3)11-17-13(19)15-9-7-8-10-16-14(20)18-12-28(24-4,25-5)26-6/h7-8H,9-12H2,1-6H3,(H2,15,17,19)(H2,16,18,20)/b8-7+ |
| InChIKey | PGECXWGZNVKSAF-BQYQJAHWSA-N |
| XLogP | -1.02 |
| TPSA | 137.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|