C55H50BN — CID 140836737
[4-(4-benzo[c]acridin-5-ylnaphthalen-1-yl)-2,3,5,6-tetramethylphenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140836737) has the molecular formula C55H50BN and a molecular weight of 735.82 g/mol. Its IUPAC name is [4-(4-benzo[c]acridin-5-ylnaphthalen-1-yl)-2,3,5,6-tetramethylphenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-(4-benzo[c]acridin-5-ylnaphthalen-1-yl)-2,3,5,6-tetramethylphenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140836737 |
| Molecular Formula | C55H50BN |
| Molecular Weight | 735.82 g/mol |
| Exact Mass | 735.40 |
| IUPAC Name | [4-(4-benzo[c]acridin-5-ylnaphthalen-1-yl)-2,3,5,6-tetramethylphenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c2c(C)c(C)c(-c3ccc(-c4cc5cc6ccccc6nc5c5ccccc45)c4ccccc34)c(C)c2C)c(C)c1 |
| InChI | InChI=1S/C55H50BN/c1-31-25-33(3)52(34(4)26-31)56(53-35(5)27-32(2)28-36(53)6)54-39(9)37(7)51(38(8)40(54)10)47-24-23-46(43-18-12-13-19-44(43)47)49-30-42-29-41-17-11-16-22-50(41)57-55(42)48-21-15-14-20-45(48)49/h11-30H,1-10H3 |
| InChIKey | ZCSIQNLSCXGSKG-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.82 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|