C34H45F5O7S2 — CID 140854874
[1-[[4-[1-(4-cyclohexylphenyl)-2-methyl-1-oxopropan-2-yl]-1,4-oxathian-4-yl]oxysulfonyl]-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate (PubChem CID 140854874) has the molecular formula C34H45F5O7S2 and a molecular weight of 724.85 g/mol. Its IUPAC name is [1-[[4-[1-(4-cyclohexylphenyl)-2-methyl-1-oxopropan-2-yl]-1,4-oxathian-4-yl]oxysulfonyl]-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate.
| Compound Name | [1-[[4-[1-(4-cyclohexylphenyl)-2-methyl-1-oxopropan-2-yl]-1,4-oxathian-4-yl]oxysulfonyl]-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 140854874 |
| Molecular Formula | C34H45F5O7S2 |
| Molecular Weight | 724.85 g/mol |
| Exact Mass | 724.25 |
| IUPAC Name | [1-[[4-[1-(4-cyclohexylphenyl)-2-methyl-1-oxopropan-2-yl]-1,4-oxathian-4-yl]oxysulfonyl]-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate |
| SMILES | CC(C)(C(=O)c1ccc(C2CCCCC2)cc1)S1(OS(=O)(=O)C(F)(F)C(OC(=O)C23CC4CC(CC(C4)C2)C3)C(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C34H45F5O7S2/c1-31(2,28(40)27-10-8-26(9-11-27)25-6-4-3-5-7-25)47(14-12-44-13-15-47)46-48(42,43)34(38,39)29(33(35,36)37)45-30(41)32-19-22-16-23(20-32)18-24(17-22)21-32/h8-11,22-25,29H,3-7,12-21H2,1-2H3 |
| InChIKey | XUXFERJBXWMEKA-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.85 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |