C18H19NaO7S — CID 140856615
sodium 2-[4-[(E)-2-[4-(2-hydroxyethoxy)phenyl]ethenyl]phenoxy]ethyl sulfate (PubChem CID 140856615) has the molecular formula C18H19NaO7S and a molecular weight of 402.40 g/mol. Its IUPAC name is sodium 2-[4-[(E)-2-[4-(2-hydroxyethoxy)phenyl]ethenyl]phenoxy]ethyl sulfate.
| Compound Name | sodium 2-[4-[(E)-2-[4-(2-hydroxyethoxy)phenyl]ethenyl]phenoxy]ethyl sulfate |
|---|---|
| PubChem CID | 140856615 |
| Molecular Formula | C18H19NaO7S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | sodium 2-[4-[(E)-2-[4-(2-hydroxyethoxy)phenyl]ethenyl]phenoxy]ethyl sulfate |
| SMILES | O=S(=O)([O-])OCCOc1ccc(/C=C/c2ccc(OCCO)cc2)cc1.[Na+] |
| InChI | InChI=1S/C18H20O7S.Na/c19-11-12-23-17-7-3-15(4-8-17)1-2-16-5-9-18(10-6-16)24-13-14-25-26(20,21)22;/h1-10,19H,11-14H2,(H,20,21,22);/q;+1/p-1/b2-1+; |
| InChIKey | ZGFQMGPPIDNXEK-TYYBGVCCSA-M |
| XLogP | -0.91 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|