C20H36O3Si — CID 140866958
ethyl (E,7S)-5-methyl-7-tri(propan-2-yl)silyloxyoct-4-en-2-ynoate (PubChem CID 140866958) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is ethyl (E,7S)-5-methyl-7-tri(propan-2-yl)silyloxyoct-4-en-2-ynoate.
| Compound Name | ethyl (E,7S)-5-methyl-7-tri(propan-2-yl)silyloxyoct-4-en-2-ynoate |
|---|---|
| PubChem CID | 140866958 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | ethyl (E,7S)-5-methyl-7-tri(propan-2-yl)silyloxyoct-4-en-2-ynoate |
| SMILES | CCOC(=O)C#C/C=C(\C)C[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H36O3Si/c1-10-22-20(21)13-11-12-18(8)14-19(9)23-24(15(2)3,16(4)5)17(6)7/h12,15-17,19H,10,14H2,1-9H3/b18-12+/t19-/m0/s1 |
| InChIKey | PUNDWFYBPSYWKT-GQEMFKIVSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|