C14H22N3+ — CID 140868367
1,3-ditert-butylbenzotriazol-3-ium (PubChem CID 140868367) has the molecular formula C14H22N3+ and a molecular weight of 232.35 g/mol. Its IUPAC name is 1,3-ditert-butylbenzotriazol-3-ium.
| Compound Name | 1,3-ditert-butylbenzotriazol-3-ium |
|---|---|
| PubChem CID | 140868367 |
| Molecular Formula | C14H22N3+ |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1,3-ditert-butylbenzotriazol-3-ium |
| SMILES | CC(C)(C)n1n[n+](C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C14H22N3/c1-13(2,3)16-11-9-7-8-10-12(11)17(15-16)14(4,5)6/h7-10H,1-6H3/q+1 |
| InChIKey | RFBUNLQMIXCNLX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|