C28H38NO3 — CID 140869824
CID 140869824 (PubChem CID 140869824) has the molecular formula C28H38NO3 and a molecular weight of 436.62 g/mol.
| Compound Name | CID 140869824 |
|---|---|
| PubChem CID | 140869824 |
| Molecular Formula | C28H38NO3 |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | — |
| SMILES | CCOc1ccc(C2CCC(c3ccc(C4CC(C)(C)N([O])C(C)(C)C4)cc3)CO2)cc1 |
| InChI | InChI=1S/C28H38NO3/c1-6-31-25-14-11-22(12-15-25)26-16-13-23(19-32-26)20-7-9-21(10-8-20)24-17-27(2,3)29(30)28(4,5)18-24/h7-12,14-15,23-24,26H,6,13,16-19H2,1-5H3 |
| InChIKey | ZHXNZVHABJEFJY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 41.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |