C8H17N — CID 140872162
1-tert-butyl-2,2,3,5-tetradeuteriopyrrolidine (PubChem CID 140872162) has the molecular formula C8H17N and a molecular weight of 131.26 g/mol. Its IUPAC name is 1-tert-butyl-2,2,3,5-tetradeuteriopyrrolidine.
| Compound Name | 1-tert-butyl-2,2,3,5-tetradeuteriopyrrolidine |
|---|---|
| PubChem CID | 140872162 |
| Molecular Formula | C8H17N |
| Molecular Weight | 131.26 g/mol |
| Exact Mass | 131.16 |
| IUPAC Name | 1-tert-butyl-2,2,3,5-tetradeuteriopyrrolidine |
| SMILES | [2H]C1CC([2H])C([2H])([2H])N1C(C)(C)C |
| InChI | InChI=1S/C8H17N/c1-8(2,3)9-6-4-5-7-9/h4-7H2,1-3H3/i4D,6D2,7D |
| InChIKey | WNMQSIGDRWCJMO-NJFZOGLQSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |