C39H70O5 — CID 140878201
2-[2-[3,3-bis(hydroxymethyl)pentoxy]-5-[2-ethyl-4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]cyclohexyl]ethyl prop-2-enoate (PubChem CID 140878201) has the molecular formula C39H70O5 and a molecular weight of 618.98 g/mol. Its IUPAC name is 2-[2-[3,3-bis(hydroxymethyl)pentoxy]-5-[2-ethyl-4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]cyclohexyl]ethyl prop-2-enoate.
| Compound Name | 2-[2-[3,3-bis(hydroxymethyl)pentoxy]-5-[2-ethyl-4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]cyclohexyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 140878201 |
| Molecular Formula | C39H70O5 |
| Molecular Weight | 618.98 g/mol |
| Exact Mass | 618.52 |
| IUPAC Name | 2-[2-[3,3-bis(hydroxymethyl)pentoxy]-5-[2-ethyl-4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]cyclohexyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC1CC(C2CCC(CCC3CCC(CCCCC)CC3)CC2CC)CCC1OCCC(CC)(CO)CO |
| InChI | InChI=1S/C39H70O5/c1-5-9-10-11-30-12-14-31(15-13-30)16-17-32-18-20-36(33(6-2)26-32)34-19-21-37(35(27-34)22-24-44-38(42)7-3)43-25-23-39(8-4,28-40)29-41/h7,30-37,40-41H,3,5-6,8-29H2,1-2,4H3 |
| InChIKey | IWGWFNNUBCIKDS-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.98 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|