C19H23BN2O4S — CID 140880316
[1-[[2-(2-ethyl-N-prop-2-enoylanilino)acetyl]amino]-2-thiophen-3-ylethyl]boronic acid (PubChem CID 140880316) has the molecular formula C19H23BN2O4S and a molecular weight of 386.28 g/mol. Its IUPAC name is [1-[[2-(2-ethyl-N-prop-2-enoylanilino)acetyl]amino]-2-thiophen-3-ylethyl]boronic acid.
| Compound Name | [1-[[2-(2-ethyl-N-prop-2-enoylanilino)acetyl]amino]-2-thiophen-3-ylethyl]boronic acid |
|---|---|
| PubChem CID | 140880316 |
| Molecular Formula | C19H23BN2O4S |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [1-[[2-(2-ethyl-N-prop-2-enoylanilino)acetyl]amino]-2-thiophen-3-ylethyl]boronic acid |
| SMILES | C=CC(=O)N(CC(=O)NC(Cc1ccsc1)B(O)O)c1ccccc1CC |
| InChI | InChI=1S/C19H23BN2O4S/c1-3-15-7-5-6-8-16(15)22(19(24)4-2)12-18(23)21-17(20(25)26)11-14-9-10-27-13-14/h4-10,13,17,25-26H,2-3,11-12H2,1H3,(H,21,23) |
| InChIKey | JEQDWPHGGQJEDS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|