About (4-aminoquinolin-2-yl) formate
(4-aminoquinolin-2-yl) formate (PubChem CID 140883773) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is (4-aminoquinolin-2-yl) formate.
Molecular Properties
| Compound Name | (4-aminoquinolin-2-yl) formate |
| PubChem CID | 140883773 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (4-aminoquinolin-2-yl) formate |
| SMILES | Nc1cc(OC=O)nc2ccccc12 |
| InChI | InChI=1S/C10H8N2O2/c11-8-5-10(14-6-13)12-9-4-2-1-3-7(8)9/h1-6H,(H2,11,12) |
| InChIKey | QCRGRFOULBLPEW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4-aminoquinolin-2-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminoquinolin-2-yl) formate?
The IUPAC name of (4-aminoquinolin-2-yl) formate (CID 140883773) is (4-aminoquinolin-2-yl) formate.
What is the SMILES notation for (4-aminoquinolin-2-yl) formate?
The canonical SMILES for (4-aminoquinolin-2-yl) formate is Nc1cc(OC=O)nc2ccccc12.
What is the InChIKey of (4-aminoquinolin-2-yl) formate?
The InChIKey is QCRGRFOULBLPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c11-8-5-10(14-6-13)12-9-4-2-1-3-7(8)9/h1-6H,(H2,11,12).
What are the key properties of (4-aminoquinolin-2-yl) formate?
(4-aminoquinolin-2-yl) formate has a molecular weight of 188.19 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminoquinolin-2-yl) formate is sourced from PubChem (CID 140883773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).