C11H6N6O2 — CID 140885595
12-nitro-1,3,6-triaza-9-azonia-8-azanidatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,9,11(16),12,14-heptaene (PubChem CID 140885595) has the molecular formula C11H6N6O2 and a molecular weight of 254.21 g/mol. Its IUPAC name is 12-nitro-1,3,6-triaza-9-azonia-8-azanidatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,9,11(16),12,14-heptaene.
| Compound Name | 12-nitro-1,3,6-triaza-9-azonia-8-azanidatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,9,11(16),12,14-heptaene |
|---|---|
| PubChem CID | 140885595 |
| Molecular Formula | C11H6N6O2 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 12-nitro-1,3,6-triaza-9-azonia-8-azanidatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,9,11(16),12,14-heptaene |
| SMILES | O=[N+]([O-])c1cccc2c1c[n+]1[n-]c3nccnc3n21 |
| InChI | InChI=1S/C11H6N6O2/c18-17(19)9-3-1-2-8-7(9)6-15-14-10-11(16(8)15)13-5-4-12-10/h1-6H |
| InChIKey | JDVUWHXGJPSEPG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 91.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|