C45H35N8OPdSi — CID 140885920
CID 140885920 (PubChem CID 140885920) has the molecular formula C45H35N8OPdSi and a molecular weight of 838.34 g/mol.
| Compound Name | CID 140885920 |
|---|---|
| PubChem CID | 140885920 |
| Molecular Formula | C45H35N8OPdSi |
| Molecular Weight | 838.34 g/mol |
| Exact Mass | 837.17 |
| IUPAC Name | — |
| SMILES | CN1c2ccccc2N(c2nc3c4c(ccc3o2)Nc2ccccc2N4[Si](c2ccccc2)c2ccccc2)c2nc(-c3cn(C)c4c3[cH-]c[n+]4C)ccc21.[Pd] |
| InChI | InChI=1S/C45H35N8OSi.Pd/c1-49-27-26-31-32(28-50(2)44(31)49)33-22-24-39-43(47-33)52(38-21-13-12-20-37(38)51(39)3)45-48-41-40(54-45)25-23-35-42(41)53(36-19-11-10-18-34(36)46-35)55(29-14-6-4-7-15-29)30-16-8-5-9-17-30;/h4-28,46H,1-3H3; |
| InChIKey | YPPZONBHQARSNW-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.34 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|