About CID 140690580
CID 140690580 (PubChem CID 140690580) has the molecular formula C44H35MnN6SSi
and a molecular weight of 762.90 g/mol.
Molecular Properties
| Compound Name | CID 140690580 |
| PubChem CID | 140690580 |
| Molecular Formula | C44H35MnN6SSi |
| Molecular Weight | 762.90 g/mol |
| Exact Mass | 762.18 |
| IUPAC Name | — |
| SMILES | CN1c2ccccc2N(c2ccc3c(n2)C([Si](c2ccccc2)c2ccccc2)c2ccccc2S3)c2nc(-c3cn(C)c4c3[cH-]c[n+]4C)ccc21.[Mn] |
| InChI | InChI=1S/C44H35N6SSi.Mn/c1-47-27-26-31-33(28-48(2)44(31)47)34-22-23-37-43(45-34)50(36-20-12-11-19-35(36)49(37)3)40-25-24-39-41(46-40)42(32-18-10-13-21-38(32)51-39)52(29-14-6-4-7-15-29)30-16-8-5-9-17-30;/h4-28,42H,1-3H3; |
| InChIKey | CCNHUFLFZNRADL-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 762.90 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 140690580 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140690580?
The IUPAC name of CID 140690580 (CID 140690580) is not available.
What is the SMILES notation for CID 140690580?
The canonical SMILES for CID 140690580 is CN1c2ccccc2N(c2ccc3c(n2)C([Si](c2ccccc2)c2ccccc2)c2ccccc2S3)c2nc(-c3cn(C)c4c3[cH-]c[n+]4C)ccc21.[Mn].
What is the InChIKey of CID 140690580?
The InChIKey is CCNHUFLFZNRADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H35N6SSi.Mn/c1-47-27-26-31-33(28-48(2)44(31)47)34-22-23-37-43(45-34)50(36-20-12-11-19-35(36)49(37)3)40-25-24-39-41(46-40)42(32-18-10-13-21-38(32)51-39)52(29-14-6-4-7-15-29)30-16-8-5-9-17-30;/h4-28,42H,1-3H3;.
What are the key properties of CID 140690580?
CID 140690580 has a molecular weight of 762.90 g/mol, XLogP of 8.17, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140690580 is sourced from PubChem (CID 140690580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).