C12H12N3O8- — CID 140893283
6-diazo-2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylamino]-5-oxohexanoate (PubChem CID 140893283) has the molecular formula C12H12N3O8- and a molecular weight of 326.24 g/mol. Its IUPAC name is 6-diazo-2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylamino]-5-oxohexanoate.
| Compound Name | 6-diazo-2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylamino]-5-oxohexanoate |
|---|---|
| PubChem CID | 140893283 |
| Molecular Formula | C12H12N3O8- |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 6-diazo-2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylamino]-5-oxohexanoate |
| SMILES | Cc1oc(=O)oc1COC(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)[O-] |
| InChI | InChI=1S/C12H13N3O8/c1-6-9(23-12(20)22-6)5-21-11(19)15-8(10(17)18)3-2-7(16)4-14-13/h4,8H,2-3,5H2,1H3,(H,15,19)(H,17,18)/p-1 |
| InChIKey | IIKQONXFPDOSLB-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 175.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|