C11H13Cl3N4 — CID 140896160
N-[(E)-(2,3-dichlorophenyl)methylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine;hydrochloride (PubChem CID 140896160) has the molecular formula C11H13Cl3N4 and a molecular weight of 307.61 g/mol. Its IUPAC name is N-[(E)-(2,3-dichlorophenyl)methylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine;hydrochloride.
| Compound Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 140896160 |
| Molecular Formula | C11H13Cl3N4 |
| Molecular Weight | 307.61 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine;hydrochloride |
| SMILES | Cl.Clc1cccc(/C=N/NC2=NCCCN2)c1Cl |
| InChI | InChI=1S/C11H12Cl2N4.ClH/c12-9-4-1-3-8(10(9)13)7-16-17-11-14-5-2-6-15-11;/h1,3-4,7H,2,5-6H2,(H2,14,15,17);1H/b16-7+; |
| InChIKey | HJSVJGGZVJKHFW-OYXUYBEVSA-N |
| XLogP | 2.69 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|