C11H11Cl2F3N4 — CID 146217329
N-[[2-chloro-6-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydrochloride (PubChem CID 146217329) has the molecular formula C11H11Cl2F3N4 and a molecular weight of 327.14 g/mol. Its IUPAC name is N-[[2-chloro-6-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydrochloride.
| Compound Name | N-[[2-chloro-6-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 146217329 |
| Molecular Formula | C11H11Cl2F3N4 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N-[[2-chloro-6-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc(Cl)c1C=NNC1=NCCN1 |
| InChI | InChI=1S/C11H10ClF3N4.ClH/c12-9-3-1-2-8(11(13,14)15)7(9)6-18-19-10-16-4-5-17-10;/h1-3,6H,4-5H2,(H2,16,17,19);1H |
| InChIKey | NJLNMGSDRRRJBX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|