C13H23N3O2 — CID 140898891
2,4-dimethoxy-6-octyl-1,3,5-triazine (PubChem CID 140898891) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2,4-dimethoxy-6-octyl-1,3,5-triazine.
| Compound Name | 2,4-dimethoxy-6-octyl-1,3,5-triazine |
|---|---|
| PubChem CID | 140898891 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2,4-dimethoxy-6-octyl-1,3,5-triazine |
| SMILES | CCCCCCCCc1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C13H23N3O2/c1-4-5-6-7-8-9-10-11-14-12(17-2)16-13(15-11)18-3/h4-10H2,1-3H3 |
| InChIKey | AFNIWWLYCHLGID-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|