C16H34N6O2 — CID 140900596
1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3-methoxycyclohexyl)urea (PubChem CID 140900596) has the molecular formula C16H34N6O2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3-methoxycyclohexyl)urea.
| Compound Name | 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3-methoxycyclohexyl)urea |
|---|---|
| PubChem CID | 140900596 |
| Molecular Formula | C16H34N6O2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3-methoxycyclohexyl)urea |
| SMILES | COC1CCCC(NC(=O)NC2NC(C)CC(NCCCN)N2)C1 |
| InChI | InChI=1S/C16H34N6O2/c1-11-9-14(18-8-4-7-17)21-15(19-11)22-16(23)20-12-5-3-6-13(10-12)24-2/h11-15,18-19,21H,3-10,17H2,1-2H3,(H2,20,22,23) |
| InChIKey | RGBDRNHYRXDSLP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|