C13H25ClN4O2 — CID 140900469
1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-methoxycyclohexyl)urea (PubChem CID 140900469) has the molecular formula C13H25ClN4O2 and a molecular weight of 304.82 g/mol. Its IUPAC name is 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-methoxycyclohexyl)urea.
| Compound Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-methoxycyclohexyl)urea |
|---|---|
| PubChem CID | 140900469 |
| Molecular Formula | C13H25ClN4O2 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-methoxycyclohexyl)urea |
| SMILES | COC1CCCC(NC(=O)NC2NC(C)CC(Cl)N2)C1 |
| InChI | InChI=1S/C13H25ClN4O2/c1-8-6-11(14)17-12(15-8)18-13(19)16-9-4-3-5-10(7-9)20-2/h8-12,15,17H,3-7H2,1-2H3,(H2,16,18,19) |
| InChIKey | MPABEVYZCLRQRE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|