C19H40N6O2 — CID 156677464
1-[4-[4-(dimethylamino)butylamino]-6-methyl-1,3-diazinan-2-yl]-3-(3-methoxycyclohexyl)urea (PubChem CID 156677464) has the molecular formula C19H40N6O2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-[4-[4-(dimethylamino)butylamino]-6-methyl-1,3-diazinan-2-yl]-3-(3-methoxycyclohexyl)urea.
| Compound Name | 1-[4-[4-(dimethylamino)butylamino]-6-methyl-1,3-diazinan-2-yl]-3-(3-methoxycyclohexyl)urea |
|---|---|
| PubChem CID | 156677464 |
| Molecular Formula | C19H40N6O2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | 1-[4-[4-(dimethylamino)butylamino]-6-methyl-1,3-diazinan-2-yl]-3-(3-methoxycyclohexyl)urea |
| SMILES | COC1CCCC(NC(=O)NC2NC(C)CC(NCCCCN(C)C)N2)C1 |
| InChI | InChI=1S/C19H40N6O2/c1-14-12-17(20-10-5-6-11-25(2)3)23-18(21-14)24-19(26)22-15-8-7-9-16(13-15)27-4/h14-18,20-21,23H,5-13H2,1-4H3,(H2,22,24,26) |
| InChIKey | VQARYVIMQCEAAN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|