C18H16F4O2 — CID 140909159
1,2,8,9-tetrafluoro-3-methoxy-7-pentyldibenzofuran (PubChem CID 140909159) has the molecular formula C18H16F4O2 and a molecular weight of 340.32 g/mol. Its IUPAC name is 1,2,8,9-tetrafluoro-3-methoxy-7-pentyldibenzofuran.
| Compound Name | 1,2,8,9-tetrafluoro-3-methoxy-7-pentyldibenzofuran |
|---|---|
| PubChem CID | 140909159 |
| Molecular Formula | C18H16F4O2 |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1,2,8,9-tetrafluoro-3-methoxy-7-pentyldibenzofuran |
| SMILES | CCCCCc1cc2oc3cc(OC)c(F)c(F)c3c2c(F)c1F |
| InChI | InChI=1S/C18H16F4O2/c1-3-4-5-6-9-7-10-13(17(21)15(9)19)14-11(24-10)8-12(23-2)16(20)18(14)22/h7-8H,3-6H2,1-2H3 |
| InChIKey | CEFRQEUIKPSVDK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|